Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 13685-23-9 | P,P-Bis(3-Methylphenyl)-Phosphinous Chloride | C14H14ClP |
| 13685-24-0 | P,P-Bis[4-(Trifluoromethyl)Phenyl]-Phosphinous Chloride | C14H8ClF6P |
| 13685-26-2 | Bis(4-Chlorophenyl)Phosphinous Chloride | C12H8Cl3P |
| 13685-30-8 | Bis(4-Methoxyphenyl)Phosphinous Chloride | C14H14ClO2P |
| 13686-33-4 | Tert-Butyl Azide | C4H9N3 |
| 13686-37-8 | 2,2,2-Trichloroethyl 2,2,2-Trichloroacetate | C4H2Cl6O2 |
| 13686-49-2 | 1-(2-Bromoethyl)-Naphthalene | C12H11Br |
| 13686-51-6 | 2-Bromo-1-(1-Naphthyl)Ethanone | C12H9BrO |
| 13686-66-3 | N,N-Diethyl-1,1-Dimethyl-Silanamine | C6H16NSi |
| 13686-87-8 | 2-Methyl-1-(Phenylmethyl)-Pyridinium Chloride | C13H14ClN |
| 13687-09-7 | P,P-Bis(1-Aziridinyl)-N-Methyl-Phosphinothioic Amide | C5H12N3PS |
| 13687-72-4 | 7-Nitro-1,2,3,4-Tetrahydrocyclopenta[b]Indole | C11H10N2O2 |
| 13687-98-4 | Ethyl 6-Ethoxy-3,6-Dihydro-2H-Pyran-2-Carboxylate | C10H16O4 |
| 13688-55-6 | 2-Propenoic Acid Trimethylsilyl Ester | C6H12O2Si |
| 13688-56-7 | Trimethylsilyl methacrylate | C7H14O2Si |
| 13688-67-0 | 1,10-Undecadiene | C11H20 |
| 13688-68-1 | 9,9-Dimethyl-9H-9-silafluorene | C14H14Si |
| 13688-90-9 | 4-(Trichlorosilyl)benzyl chloride | C7H6Cl4Si |
| 13689-19-5 | Tricyclohexylphosphine oxide | C18H33OP |
| 13689-20-8 | Cyclohexyldiphenyl-Phosphine Oxide | C18H21OP |
| 13689-92-4 | Nickel thiocyanate | C10H11NO2 |
| 13691-22-0 | 1-(4-Aminophenyl)pyrrolidin-2-one | C10H12N2O |
| 13691-26-4 | 1-(4-Nitrophenyl)-2-Pyrrolidinone | C10H10N2O3 |
| 13691-28-6 | 1-(4-Aminophenyl)-5-Methylpyrrolidin-2-One | C11H14N2O |
| 13691-29-7 | 1-(4-Amino-2-Methylphenyl)Pyrrolidin-2-One | C11H14N2O |
| 13691-84-4 | 3'-Trifluoromethylcyclopentanecarboxanilide | C13H14F3NO |
| 13692-14-3 | 2,4-Dichloro-alpha-(Chloromethyl)-Benzenemethanol | C8H7Cl3O |
| 13692-15-4 | (2,4-Dichlorophenyl)Oxirane | C8H6Cl2O |
| 13692-92-7 | Trivanadium Yttrium Nonaoxide | O4VY |
| 13692-98-3 | Samarium Sulfate | O12S3Sm2 |
| 13693-05-5 | Platinum Hexafluoride | F6Pt |
| 13693-06-6 | Plutoniumhexafluoride | F6Pu |
| 13693-09-9 | Xenon Hexafluoride | F6Xe |
| 13693-11-3 | Sulfuric Acid Titanium Salt (2:1) | O8S2Ti |
| 13694-07-0 | 4-(4-Morpholinylmethyl)-2(1H)-Quinolinone | C14H16N2O2 |
| 13694-13-8 | 2-(4-Bromo-Phenyl)-7-Methyl-Imidazo[1,2-a]Pyrimidine | C13H10BrN3 |
| 13694-51-4 | 1-(4-Fluorophenyl)-4-(2-Methoxy-2-Phenyl-Ethyl)Piperazine Hydrochloride | C19H24ClFN2O |
| 13694-84-3 | Tetrahydrofuran-3-yl toluene-4-sulfonate | C11H14O4S |
| 13695-28-8 | Diethyl(2-Hydroxyethyl)Ammonium Acetate | C8H19NO3 |
| 13695-31-3 | 2,2,3,3,4,4,4-Heptafluorobutyl methacrylate | C8H7F7O2 |
| 13696-15-6 | 3-[(2-Hydroxy-2,2-Diphenylacetyl)Oxy]-1,1-Dimethyl-Pyrrolidinium Bromide (1:1) | C20H24BrNO3 |
| 13697-84-2 | 1-Methoxy-5-Methyl-1,4-Cyclohexadiene | C8H12O |
| 13697-89-7 | 2,6-Difluoroiodobenzene | C6H3F2I |
| 13698-16-3 | N,N-Dichlorourethane | C3H5Cl2NO2 |
| 13698-42-5 | Quinoxaline-3,4-Dihydro-6,7-Dimethyl-3-Keto-4-D-Ribityl-2-Carboxamide | C16H21N3O6 |
| 13698-49-2 | Delmadinone acetate | C23H27ClO4 |
| 13698-55-0 | Lead Fumarate Tetrabasic | C4H2O4Pb |
| 13698-87-8 | N,N,N',N'-tetraethylbenzene-1,3-dicarboxamide | C16H24N2O2 |
| 13698-89-0 | 1,5-Diamino-4,8-Dihydroxy-2-(4-Methoxyphenyl)Anthraquinone | C21H16N2O5 |
| 13699-45-1 | Myristoyllysophosphatidylcholine | C22H46NO7P |