| Product Name |
CAS Registry Number |
Molecular Formula |
| 1,2,3,4,4a,5,6,7a,9,11a,11b,11c-Dodecahydro-4,4,8,11c-tetramethyl-bisoxireno[1,10a:3,4]phenanthro[3,2-b]furan-9-ol | 116360-82-8 | C20H28O4 |
| (1S,2S,3aR,4R,4aS,4bS,6R,8S,8aS,9aR,10R,10aR)-Dodecahydro-2,4a,6,9a-tetramethylcyclopenta[b]fluorene-1,3a,4,6,8,8a,10(1H,4H)-heptol 4,8,8a,10-tetraacetate 1-benzoate | 219916-77-5 | C35H46O12 |
| Dodecahydro-3,8,8,11alpha-Tetramethyl-5H-3,5alpha-Epoxynaphth[2,1-c]Oxepin | 57345-19-4 | C18H30O2 |
| [4aR-(4aalpha,6abeta,10aalpha,10bbeta)]-Dodecahydro-4a,7,7,10a-Tetramethyl-3H-Naphth[2,1-b]Pyran-3-One | 468-84-8 | C17H28O2 |
| Dodecahydro-4H,8H,12H-4a,8a,12alpha-Triazatriphenylene | 522-33-8 | C15H27N3 |
| (2S-(2alpha,4alpha,4abeta,5abeta,7beta,8beta,10aalpha,11alpha-alpha,12S*))-Dodecahydro-3,3,7-Trimethyl-11-Methylene-5a,8-Methano-5aH-Cyclohepta(b)Naphthalene-2,4,4a,7,12(5H)-Pentol | 38302-26-0 | C20H32O5 |
| Dodecahydro-2,5,8-Trimethyl-1,4,7,9B-Tetraazaphenalene | 7034-04-0 | C12H24N4 |
| Dodecahydrotriphenylene | 1610-39-5 | C18H24 |
| Dodecahydro-N,N',N''-Triphenyl-1,4,7,9b-Tetraazaphenalene-1,4,7-Tricarboxamide | 10553-79-4 | C30H33N7O3 |
| Dodecahydro-1,4,7-Tris(O-Tolylcarbamoyl)-1,4,7,9b-Tetraazaphenalene | 74039-53-5 | C33H39N7O3 |
| Dodecairon Lead Nonadecaoxide | 12023-90-4 | Fe2O5Pb2 |
| delta-Dodecalactone | 713-95-1 | C12H22O2 |
| 31,32,33,34,35,36,37,38,39,40,41,42-Dodecamethoxy-5,10,15,20,25,30-hexakis(methoxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29-dodecaoxaheptacyclo[26.2.2.23,6.28,11.213,16.218,21.223,26]dotetracontane | 68715-56-0 | C54H96O30 |
| Dodecamethylcyclohexasilane | 4098-30-0 | C12H36Si6 |
| Dodecamethylcyclohexasiloxane | 540-97-6 | C12H36O6Si6 |
| 2,2,3,3,5,5,6,6,8,8,9,9-Dodecamethyl-4,7-Dioxa-2,3,5,6,8,9-Hexasiladecane | 1787-37-7 | C14H42O2Si6 |
| 1,1'-Dodecamethylenediguanidinium Dichloride | 61167-43-9 | C14H34Cl2N6 |
| Dodecamethylpentasiloxane | 141-63-9 | C12H36O4Si5 |
| Dodecamethyl-[6]Pericyclyne | 98127-90-3 | C30H36 |
| Dodecanamine | 124-22-1 | C12H27N |
| Dodecane | 112-40-3 | C12H26 |
| (2H26)Dodecane | 16416-30-1 | C12D26 |
| Dodecane | 1652-96-6 | C12H24 |
| Dodecane-1-14C | 5908-50-9 | C21H13ClN2O4 |
| DODECANE | 93685-81-5 | |
| 1,12-Dodecanebisphosphonic acid | 7450-59-1 | C12H28O6P2 |
| Dodecanedial | 38279-34-4 | C12H22O2 |
| Dodecanediamide | 6224-99-3 | C12H24N2O2 |
| 1,12-Dodecanediamine | 2783-17-7 | C12H28N2 |
| 1,12-Dodecanediamine bis[bis[2-[2-(dodecyloxy)ethoxy]ethyl] phosphate] | 94108-72-2 | 2(C32H67O8P).C12H28N2 |
| 1,12-Dodecanedinitrile | 4543-66-2 | C12H20N2 |
| 1,12-Dodecanedioic acid | 693-23-2 | C12H22O4 |
| 1,12-Dodecanedioic-D20 Acid | 89613-32-1 | |
| Dodecanedioic acid ammoniate (1:1) | 72447-43-9 | C12H25NO4 |
| Dodecanedioic Acid Diethyl Ester | 10471-28-0 | C16H30O4 |
| Dodecanedioic Acid Di(2-Ethylhexyl) Ester | 19074-24-9 | C28H54O4 |
| Dodecanedioic Acid 1-Methyl Ester Barium Salt | 122107-56-6 | C26H48BaO8 |
| Dodecanedioic acid monoethyl ester | 66003-63-2 | C14H26O4 |
| Dodecanedioic Acid Monomethyl Ester | 3903-40-0 | C13H24O4 |
| Dodecanedioic Acid, Polymer With 6-Aminohexanoic Acid, Decanedioic Acid, 1,6-Hexanediamine And Hexanedioic Acid | 71215-68-4 | C40H79N3O14 |
| Dodecanedioic Acid, Polymer With Decanedioic Acid, Hexahydro-2H-Azepin-2-One And 1,6-Hexanediamine | 52257-07-5 | C34H67N3O9 |
| Dodecanedioic acid, polymer with 1,12-dodecanediamine | 36497-34-4 | C24H50N2O4 |
| Dodecanedioic Acid, Polymer With Hexahydro-2H-Azepin-2-One And 1,6-Hexanediamine | 51733-10-9 | C24H49N3O5 |
| Dodecanedioic acid sodium salt, compd. with 2,2',2''-nitrilotris[ethanol] | 85049-97-4 | C12H22O4.x(C6H15NO3).x(Na) |
| 1,2-Dodecanediol | 1119-87-5 | C12H26O2 |
| 1,12-Dodecanediol | 5675-51-4 | C12H26O2 |
| (5S,6R)-5,6-Dodecanediol | 70859-32-4 | C12H26O2 |
| (5R,6R)-5,6-Dodecanediol | 70859-33-5 | C12H26O2 |
| (R)-1,2-Dodecanediol | 85514-84-7 | |
| (S)-1,2-Dodecanediol | 85514-85-8 | C12H26O2 |