| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Abblis Chemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (832) 373-8299 | |||
![]() |
info@abblis.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sequoia Research Products Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (7802) 291-086 | |||
![]() |
info@seqchem.com | |||
| Chemical distributor | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 1,3,3-Trimethyl-2-[3,7,12,16-Tetramethyl-18-(2,6,6-Trimethyl-1-Cyclohexenyl)Octadeca-1,3,5,7,9,11,13,15,17-Nonaenyl]Cyclohexene |
|---|---|
| Synonyms | 1,3,3-Trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-Tetramethyl-18-(2,6,6-Trimethyl-1-Cyclohexenyl)Octadeca-1,3,5,7,9,11,13,15,17-Nonaenyl]Cyclohexene; Hsdb 3264; Kpmk |
| Molecular Structure | ![]() |
| Molecular Formula | C40H56 |
| Molecular Weight | 536.88 |
| CAS Registry Number | 116-32-5 (31797-85-0) |
| SMILES | CC1(C(=C(CCC1)C)\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(\C=C\C2=C(CCCC2(C)C)C)C)C)C)C)C |
| InChI | 1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | OENHQHLEOONYIE-JLTXGRSLSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 178°C (Expl.) |
| Boiling point | 654.7±22.0°C at 760 mmHg (Cal.) |
| Flash point | 346.0±17.2°C (Cal.) |
| 103°C (Expl.) | |
| Safety Description | Minimize contact. |
|---|---|
| (1) | Thomas LenzerCurrent address: Universität Siegen, Physikalische Chemie, Fachbereich 8 (Chemie-Biologie), Adolf-Reichwein-Str. 2, 57076 Siegen, Germany., Florian Ehlers, Mirko Scholz, Rainer Oswald and Kawon Oum. Assignment of carotene S* state features to the vibrationally hot ground electronic state, Phys. Chem. Chem. Phys., 2010, 12, 8832. |
|---|---|
| Market Analysis Reports |