|
CAS#: 1982-55-4 Product: 4,5,7-Trichloro-2,1,3-Benzothiadiazole No suppilers available for the product. |
| Name | 4,5,7-Trichloro-2,1,3-Benzothiadiazole |
|---|---|
| Synonyms | 4,5,7-Trichloropiazthiole; 052 H; 2,1,3-Benzothiadiazole, 4,5,7-Trichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6HCl3N2S |
| Molecular Weight | 239.51 |
| CAS Registry Number | 1982-55-4 |
| SMILES | C2=C(C1=NSN=C1C(=C2Cl)Cl)Cl |
| InChI | 1S/C6HCl3N2S/c7-2-1-3(8)5-6(4(2)9)11-12-10-5/h1H |
| InChIKey | SZYWFOPNFNROQB-UHFFFAOYSA-N |
| Density | 1.77g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.732°C at 760 mmHg (Cal.) |
| Flash point | 146.564°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |