| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Name | Halocarban |
|---|---|
| Synonyms | Halocarban; Halocarbano [Inn-Spanish]; Halocarbanum [Inn-Latin] |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9Cl2F3N2O |
| Molecular Weight | 349.14 |
| CAS Registry Number | 369-77-7 |
| EINECS | 206-724-5 |
| SMILES | C1=C(C(F)(F)F)C(=CC=C1NC(NC2=CC=C(C=C2)Cl)=O)Cl |
| InChI | 1S/C14H9Cl2F3N2O/c15-8-1-3-9(4-2-8)20-13(22)21-10-5-6-12(16)11(7-10)14(17,18)19/h1-7H,(H2,20,21,22) |
| InChIKey | ZFSXZJXLKAJIGS-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.8±42.0°C at 760 mmHg (Cal.) |
| Flash point | 152.7±27.9°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Young-Hye La, Ratnam Sooriyakumaran, Dolores C. Miller, Masaki Fujiwara, Yoshiharu Terui, Kazuhiro Yamanaka, Bryan D. McCloskey, Benny D. Freeman and Robert D. Allen. Novel thin film composite membrane containing ionizable hydrophobes: pH-dependent reverse osmosis behavior and improved chlorine resistance, J. Mater. Chem., 2010, 20, 4615. |
|---|---|
| Market Analysis Reports |