| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| AvaChem Scientific LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (210) 667-3815 | |||
![]() |
chemsupply@avachem.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| RIA International LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | (1'R,3'S,3S,5R,6R)-5-Amino-2-Aminomethyl-6-(4,6-Diamino-2,3-Dihydroxy-Cyclohexyloxy)-Tetrahydro-Pyran-3,4-Diol |
| Synonyms | (2R,3S,4R,5R,6R)-5-Amino-2-(Aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-Diamino-2,3-Dihydroxy-Cyclohexoxy]Tetrahydropyran-3,4-Diol; (2R,3S,4R,5R,6R)-5-Amino-2-(Aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-Diamino-2,3-Dihydroxycyclohexoxy]Tetrahydropyran-3,4-Diol; (2R,3S,4R,5R,6R)-5-Amino-2-(Aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-Diamino-2,3-Dihydroxy-Cyclohexyl]Oxy-Oxane-3,4-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26N4O6 |
| Molecular Weight | 322.36 |
| CAS Registry Number | 3947-65-7 |
| SMILES | [C@H]2(O[C@H]1O[C@@H]([C@@H](O)[C@@H]([C@H]1N)O)CN)[C@@H]([C@H]([C@H](N)C[C@@H]2N)O)O |
| InChI | 1S/C12H26N4O6/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20/h3-12,17-20H,1-2,13-16H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | SYJXFKPQNSDJLI-HKEUSBCWSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 577.9±50.0°C at 760 mmHg (Cal.) |
| Flash point | 303.3±30.1°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Yun Xie, Andrew V. Dix and Yitzhak Tor. Antibiotic selectivity for prokaryotic vs. eukaryotic decoding sites, Chem. Commun., 2010, 46, 5542. |
|---|---|
| Market Analysis Reports |