| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | 4-(2-Chloro-1,1,2-Trifluoro-Ethoxy)-Phenylamine |
| Synonyms | 4-(2-Chloro-1,1,2-Trifluoro-Ethoxy)Aniline; [4-(2-Chloro-1,1,2-Trifluoro-Ethoxy)Phenyl]Amine; Nsc158368 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7ClF3NO |
| Molecular Weight | 225.60 |
| CAS Registry Number | 403-61-2 |
| SMILES | C1=C(OC(C(F)Cl)(F)F)C=CC(=C1)N |
| InChI | 1S/C8H7ClF3NO/c9-7(10)8(11,12)14-6-3-1-5(13)2-4-6/h1-4,7H,13H2 |
| InChIKey | KRJGYZGOFPUZRH-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.177°C at 760 mmHg (Cal.) |
| 130.5-131°C (Expl.) | |
| Flash point | 112.965°C (Cal.) |
| Refractive index | 1.49 (Expl.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |