| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | alpha-Phenyl-Benzenemethanethiol |
|---|---|
| Synonyms | Diphenylmethanethiol; Benzenemethanethiol, .Alpha.-Phenyl-; Benzhydryl Hydrosulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12S |
| Molecular Weight | 200.30 |
| CAS Registry Number | 4237-48-3 |
| SMILES | C2=C(C(S)C1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C13H12S/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | ORKZATPRQQSLDT-UHFFFAOYSA-N |
| Density | 1.091g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.214°C at 760 mmHg (Cal.) |
| Flash point | 125.823°C (Cal.) |
| (1) | Minoru Yamaji, Jun-ichi Kobayashi and Seiji Tobita. Photochemical reactions of triplet p-phenylbenzyl derivatives studied by using laser flash triplet-sensitization techniques, Photochem. Photobiol. Sci., 2005, 4, 294. |
|---|---|
| Market Analysis Reports |