| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Classification | Organic raw materials >> Organometallic salt |
|---|---|
| Name | Zinc Oleate |
| Synonyms | 9-Octadecenoic Acid (9Z)-, Zinc Salt; 9-Octadecenoic Acid (Z), Zinc Salt (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C36H66O4Zn |
| Molecular Weight | 628.30 |
| CAS Registry Number | 557-07-3 |
| EINECS | 209-154-5 |
| SMILES | C(C([O-])=O)CCCCCC\C=C/CCCCCCCC.C(C([O-])=O)CCCCCC\C=C/CCCCCCCC.[Zn++] |
| InChI | 1S/2C18H34O2.Zn/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);/q;;+2/p-2/b2*10-9-; |
| InChIKey | LPEBYPDZMWMCLZ-CVBJKYQLSA-L |
| Boiling point | 360°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 270.1°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Stijn Flamee, Ruben Dierick, Marco Cirillo, Dirk Van Genechten, Tangi Aubert and Zeger Hens. Synthesis of metal selenide colloidal nanocrystals by the hot injection of selenium powder, Dalton Trans., 2013, 42, 12654. |
|---|---|
| Market Analysis Reports |