| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Exclusive Chemistry Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (903) 713-5556 | |||
![]() |
info@exchemistry.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-Hydroxynaphthalene-2-Carbaldehyde |
|---|---|
| Synonyms | 3-Hydroxy-2-Naphthalenecarboxaldehyde; Ec-000.1489; Nsc240729 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 581-71-5 |
| SMILES | C2=CC1=CC(=C(C=C1C=C2)O)C=O |
| InChI | 1S/C11H8O2/c12-7-10-5-8-3-1-2-4-9(8)6-11(10)13/h1-7,13H |
| InChIKey | QCUNDLUTTXSPFM-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.989°C at 760 mmHg (Cal.) |
| Flash point | 134.332°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Annemarie McCarthy and Albert A. Ruth. Fluorescence excitation and excited state intramolecular proton transfer of jet-cooled naphthol derivatives: Part 1. 1-hydroxy-2-naphthaldehyde, Phys. Chem. Chem. Phys., 2011, 13, 7485. |
|---|---|
| Market Analysis Reports |