Online Database of Chemicals from Around the World

Ethyl 3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxylate
[CAS 74416-91-4]

List of Suppliers
Fenhe Chemical Co., Ltd. China
www.fenhechem.com
+86 (021) 3392-6068
julius.wei@fenhechem.com
Chemical manufacturer since 1997
chemBlink Standard supplier since 2024

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives
NameEthyl 3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxylate
Molecular StructureEthyl 3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxylate molecular structure (CAS 74416-91-4)
Molecular FormulaC15H14N2O2S
Molecular Weight286.35
CAS Registry Number74416-91-4
SMILESCCOC(=O)C1=C(N2C=C(N=C2S1)C3=CC=CC=C3)C
Properties
Density1.3±0.1 g/cm3, Calc.*
Index of Refraction1.653, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
up chemBlink Chemical Story
Ethyl 3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxylate is a compound of significant interest due to its unique structure and potential applications in chemical and pharmaceutical research. This molecule is part of the imidazo[2,1-b][1,3]thiazole class, which is characterized by a fused ring system that combines imidazole and thiazole rings with additional substituents enhancing its chemical properties.

The discovery of Ethyl 3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxylate stems from research into the synthesis and study of heterocyclic compounds. Its structure includes a methyl group, a phenyl group, and an ethyl ester group attached to the imidazo[2,1-b][1,3]thiazole ring system. These substituents contribute to the compound's unique reactivity and biological activity.

In medicinal chemistry, Ethyl 3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxylate has been explored for its potential therapeutic properties. The imidazo[2,1-b][1,3]thiazole scaffold is known for its biological activities, including anticancer and antimicrobial effects. Researchers are investigating how the specific substituents in this compound influence its interaction with biological targets. The presence of the phenyl and ethyl ester groups may enhance the compound's activity and selectivity, making it a promising candidate for drug development.

The compound also has applications in materials science due to its ability to participate in various chemical reactions. The imidazo[2,1-b][1,3]thiazole structure can be used to develop new materials with specific properties. For example, Ethyl 3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxylate can be employed as a building block in the synthesis of advanced organic materials and polymers, where its unique chemical properties contribute to the desired characteristics of the final products.

Furthermore, the compound’s ability to act as a reactive intermediate makes it valuable in organic synthesis. It can be used to create more complex molecules, facilitating the development of new chemical entities with potential applications in various fields.

Overall, Ethyl 3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxylate is a compound with significant potential due to its unique structure and reactivity. Its applications in medicinal chemistry and materials science highlight its versatility and importance in advancing both drug development and material innovation.
Market Analysis Reports
Related Products
1-Ethyl-1-(3-me...  N-(2-Ethyl-6-me...  (2-Ethyl-6-meth...  9-Ethyl-3-(N-Me...  N-(2-Ethyl-4-Me...  N-(2-Ethyl-6-Me...  2-Ethyl-4-methy...  Ethyl 2-methyl-...  5-Ethyl-1-Methy...  1-Ethyl-5-(4-Me...  3-Ethyl-1-methy...  2-Ethyl-6-Methy...  Ethyl 5-methyl-...  N-(2-Ethyl-6-Me...  N-Ethyl-N-(3-me...  N-(2-Ethyl-6-Me...  N-(2-Ethyl-6-Me...  Ethyl 2-[(1R)-2...  [(2-Ethyl-6-Met...  2-[(2-Ethyl-6-M...