| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | 2-Isovaleryl-1,3-Indanedione |
|---|---|
| Synonyms | 2-(3-Methylbutanoyl)Indane-1,3-Dione; 2-(3-Methyl-1-Oxobutyl)Indane-1,3-Dione; 2-Isovalerylindane-1,3-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 |
| CAS Registry Number | 83-28-3 |
| EINECS | 201-464-9 |
| SMILES | C1=CC=CC2=C1C(C(C2=O)C(CC(C)C)=O)=O |
| InChI | 1S/C14H14O3/c1-8(2)7-11(15)12-13(16)9-5-3-4-6-10(9)14(12)17/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | PVWMAOPFDINGAY-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.594°C at 760 mmHg (Cal.) |
| Flash point | 170.024°C (Cal.) |
| (1) | Jonathan Lowther, Beverley A. Yard, Kenneth A. Johnson, Lester G. Carter, Venugopal T. Bhat, Marine C. C. Raman, David J. Clarke, Britta Ramakers, Stephen A. McMahon, James H. Naismith and Dominic J. Campopiano. Inhibition of the PLP-dependent enzyme serine palmitoyltransferase by cycloserine: evidence for a novel decarboxylative mechanism of inactivation, Mol. Biosyst., 2010, 6, 1682. |
|---|---|
| Market Analysis Reports |