| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Halogenation, sulfonation, nitration or nitrosation of carboxylic acids |
|---|---|
| Name | 1-Amino-8-Naphthol-4-Sulfonic Acid |
| Synonyms | 4-Amino-5-Hydroxy-Naphthalene-1-Sulfonic Acid; 4-Amino-5-Hydroxy-1-Naphthalenesulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 |
| CAS Registry Number | 83-64-7 |
| EINECS | 201-491-6 |
| SMILES | C1=CC=C(C2=C(C=CC(=C12)[S](O)(=O)=O)N)O |
| InChI | 1S/C10H9NO4S/c11-7-4-5-9(16(13,14)15)6-2-1-3-8(12)10(6)7/h1-5,12H,11H2,(H,13,14,15) |
| InChIKey | LRDIEHDJWYRVPT-UHFFFAOYSA-N |
| Density | 1.627g/cm3 (Cal.) |
|---|---|
| SDS | Available |
|---|---|
| Market Analysis Reports |