| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alfa Pyridines | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | API >> Vitamins and minerals >> Vitamin B drugs |
|---|---|
| Name | Pyridoxamine |
| Synonyms | 4-(Aminomethyl)-5-(Hydroxymethyl)-2-Methyl-Pyridin-3-Ol; 4-(Aminomethyl)-2-Methyl-5-Methylol-Pyridin-3-Ol; Chebi:16410 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 |
| CAS Registry Number | 85-87-0 |
| EINECS | 201-640-5 |
| SMILES | C1=C(C(=C(C(=N1)C)O)CN)CO |
| InChI | 1S/C8H12N2O2/c1-5-8(12)7(2-9)6(4-11)3-10-5/h3,11-12H,2,4,9H2,1H3 |
| InChIKey | NHZMQXZHNVQTQA-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.103°C at 760 mmHg (Cal.) |
| Flash point | 232.062°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Hanes et al.. 13C-NMR snapshots of the complex reaction coordinate of pyridoxal phosphate synthase, Nature Chemical Biology, 2008 |
|---|---|
| Market Analysis Reports |