| R&D Scientific Inc. | Canada | |||
|---|---|---|---|---|
![]() | www.rdscientific.com | |||
![]() | +1 (226) 600-0236 | |||
![]() | sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Threonine derivative |
|---|---|
| Name | 3,5-Dihydroxy-2-naphthoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 |
| CAS Registry Number | 89-35-0 |
| EC Number | 201-900-8 |
| SMILES | C1=CC2=CC(=C(C=C2C(=C1)O)O)C(=O)O |
| Solubility | 488 mg/L (25 °C water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.762, Calc.* |
| Melting point | 170.33 °C |
| Boiling Point | 409.50 °C, 442.2±35.0 °C (760 mmHg), Calc.* |
| Flash Point | 235.3±22.4 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H335 Details | ||||||||||||||||
| Safety Statements | P261-P305+P351+P338 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |