|
CAS#: 896-32-2 Product: 2,2,2-Triphenylethyl Alcohol No suppilers available for the product. |
| Name | 2,2,2-Triphenylethyl Alcohol |
|---|---|
| Synonyms | 2,2,2-Triphenylethanol; Benzeneethanol, .Beta.,.Beta.-Diphenyl-; Nsc54125 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 |
| CAS Registry Number | 896-32-2 |
| SMILES | C1=CC=C(C=C1)C(CO)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C20H18O/c21-16-20(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,21H,16H2 |
| InChIKey | KXGOCPRLOMWVLP-UHFFFAOYSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.359°C at 760 mmHg (Cal.) |
| Flash point | 161.754°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | G. Ferguson, C. Glidewell and C. M. Zakaria. 2,2,2-Triphenylethanol: a hydrogen-bonded tetramer based upon a centrosymmetric R4(8) motif, Acta Cryst. (1994). C50, 928-931 |
|---|---|
| Market Analysis Reports |