| Activate Scientific GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (8051) 965-1660 | |||
![]() |
rschmitt@activate-scientific.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Synthonix, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (919) 875-9277 | |||
![]() |
info@synthonix.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Pteridine |
|---|---|
| Synonyms | Inchi=1/C6h4n4/C1-2-9-6-5(8-1)3-7-4-10-6/H1-4; Pyrimido(4,5-B)Pyrazine; Nsc 268562 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.12 |
| CAS Registry Number | 91-18-9 |
| SMILES | C1=NC=NC2=C1N=CC=N2 |
| InChI | 1S/C6H4N4/c1-2-9-6-5(8-1)3-7-4-10-6/h1-4H |
| InChIKey | CPNGPNLZQNNVQM-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.999°C at 760 mmHg (Cal.) |
| Flash point | 124.662°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |