| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | 2-Methyl-5-(1-Methylethenyl)-2-Cyclohexen-1-Ol 1-Propanoate |
| Synonyms | (5-Isopropenyl-2-Methyl-1-Cyclohex-2-Enyl) Propanoate; Propanoic Acid (5-Isopropenyl-2-Methyl-1-Cyclohex-2-Enyl) Ester; Propionic Acid (5-Isopropenyl-2-Methyl-1-Cyclohex-2-Enyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 97-45-0 |
| EINECS | 202-583-9 |
| FEMA | 2251 |
| SMILES | C(C(OC1CC(CC=C1C)C(C)=C)=O)C |
| InChI | 1S/C13H20O2/c1-5-13(14)15-12-8-11(9(2)3)7-6-10(12)4/h6,11-12H,2,5,7-8H2,1,3-4H3 |
| InChIKey | DFVXNZOMAOGTBL-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.546°C at 760 mmHg (Cal.) |
| Flash point | 107.778°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |