|
CAS#: 120202-64-4 Product: Ervayunine No suppilers available for the product. |
| Name | Ervayunine |
|---|---|
| Synonyms | (-)-Ervayunine; 2H-3,13-Methanooxireno(9,10)Azacycloundecino(5,4-B)Indole, 13-Ethyl-1A,4,5,10,11,12,13,13A-Octahydro-, (1As,13R,13Ar)-; 2H-3,13-Methanooxireno(9,10)Azacycloundecino(5,4-B)Indole, 13-Ethyl-1A,4,5,10,11,12,13,13A-Octahydro-, (1As-(1Ar*,13S*,13As*))- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 |
| CAS Registry Number | 120202-64-4 |
| SMILES | C5=C4C2=C(CCC3(C1OC1CN(CC2)C3)CC)[NH]C4=CC=C5 |
| InChI | 1S/C19H24N2O/c1-2-19-9-7-16-14(13-5-3-4-6-15(13)20-16)8-10-21(12-19)11-17-18(19)22-17/h3-6,17-18,20H,2,7-12H2,1H3 |
| InChIKey | OGDFTQDRHAGLTB-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.881°C at 760 mmHg (Cal.) |
| Flash point | 232.533°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ervayunine |