|
CAS#: 122228-35-7 Product: Englitazone No suppilers available for the product. |
| Name | Englitazone |
|---|---|
| Synonyms | 5-[[2-(Phenylmethyl)Chroman-6-Yl]Methyl]Thiazolidine-2,4-Dione; 5-[[2-(Phenylmethyl)-6-Chromanyl]Methyl]Thiazolidine-2,4-Dione; 5-[[2-(Benzyl)Chroman-6-Yl]Methyl]Thiazolidine-2,4-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 |
| CAS Registry Number | 122228-35-7 |
| SMILES | C2=C(CC1C(NC(S1)=O)=O)C=CC3=C2CCC(O3)CC4=CC=CC=C4 |
| InChI | 1S/C20H19NO3S/c22-19-18(25-20(23)21-19)12-14-6-9-17-15(10-14)7-8-16(24-17)11-13-4-2-1-3-5-13/h1-6,9-10,16,18H,7-8,11-12H2,(H,21,22,23) |
| InChIKey | MVDXXGIBARMXSA-UHFFFAOYSA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 562.71°C at 760 mmHg (Cal.) |
| Flash point | 294.116°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Englitazone |