|
CAS#: 142733-20-8 Product: 1-[1-(2-Chlorophenyl)-2-Dimethylaminoethyl]Cyclohexan-1-Ol No suppilers available for the product. |
| Name | 1-[1-(2-Chlorophenyl)-2-Dimethylaminoethyl]Cyclohexan-1-Ol |
|---|---|
| Synonyms | 1-[1-(2-Chlorophenyl)-2-Dimethylamino-Ethyl]Cyclohexan-1-Ol; 1-[1-(2-Chlorophenyl)-2-Dimethylaminoethyl]-1-Cyclohexanol; Wy 45,818 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.82 |
| CAS Registry Number | 142733-20-8 |
| SMILES | C1=C(C(=CC=C1)C(C2(CCCCC2)O)CN(C)C)Cl |
| InChI | 1S/C16H24ClNO/c1-18(2)12-14(13-8-4-5-9-15(13)17)16(19)10-6-3-7-11-16/h4-5,8-9,14,19H,3,6-7,10-12H2,1-2H3 |
| InChIKey | OVSAXOVRTVDPOU-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.942°C at 760 mmHg (Cal.) |
| Flash point | 184.187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-(2-Chlorophenyl)-2-Dimethylaminoethyl]Cyclohexan-1-Ol |