|
CAS#: 14600-07-8 Product: 2-Butenyl (2,4-Dichlorophenoxy)Acetate No suppilers available for the product. |
| Name | 2-Butenyl (2,4-Dichlorophenoxy)Acetate |
|---|---|
| Synonyms | 2-(2,4-Dichlorophenoxy)Acetic Acid [(E)-But-2-Enyl] Ester; [(E)-But-2-Enyl] 2-(2,4-Dichlorophenoxy)Ethanoate; 2,4-D Crotyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 |
| CAS Registry Number | 14600-07-8 |
| SMILES | C1=C(Cl)C=CC(=C1Cl)OCC(OC\C=C\C)=O |
| InChI | 1S/C12H12Cl2O3/c1-2-3-6-16-12(15)8-17-11-5-4-9(13)7-10(11)14/h2-5,7H,6,8H2,1H3/b3-2+ |
| InChIKey | BZHQSLLUNKPKPL-NSCUHMNNSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.716°C at 760 mmHg (Cal.) |
| Flash point | 141.397°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Butenyl (2,4-Dichlorophenoxy)Acetate |