|
CAS#: 16231-75-7 Product: Atolide No suppilers available for the product. |
| Name | Atolide |
|---|---|
| Synonyms | 2-Amino-N-(4-Diethylamino-2-Methyl-Phenyl)Benzamide; 2-Amino-4'-(Diethylamino)-O-Benzotoluidide; 4'-Diethylamino-2'-Methylanthranilanilid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 |
| CAS Registry Number | 16231-75-7 |
| SMILES | C1=CC=CC(=C1C(NC2=C(C=C(N(CC)CC)C=C2)C)=O)N |
| InChI | 1S/C18H23N3O/c1-4-21(5-2)14-10-11-17(13(3)12-14)20-18(22)15-8-6-7-9-16(15)19/h6-12H,4-5,19H2,1-3H3,(H,20,22) |
| InChIKey | MMPYYZUCLBHNSK-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.75°C at 760 mmHg (Cal.) |
| Flash point | 205.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Atolide |