|
CAS#: 19178-84-8 Product: 1-Methyl-4-(9H-Xanthen-9-Yl)Piperazine No suppilers available for the product. |
| Name | 1-Methyl-4-(9H-Xanthen-9-Yl)Piperazine |
|---|---|
| Synonyms | Nsc25187 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 |
| CAS Registry Number | 19178-84-8 |
| SMILES | C1=CC=CC3=C1C(N2CCN(C)CC2)C4=C(O3)C=CC=C4 |
| InChI | 1S/C18H20N2O/c1-19-10-12-20(13-11-19)18-14-6-2-4-8-16(14)21-17-9-5-3-7-15(17)18/h2-9,18H,10-13H2,1H3 |
| InChIKey | XLJHWPSAOJRZQK-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.009°C at 760 mmHg (Cal.) |
| Flash point | 109.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-(9H-Xanthen-9-Yl)Piperazine |