|
CAS#: 2091-61-4 Product: 1-(2-Chlorophenoxy)-4-Nitrobenzene No suppilers available for the product. |
| Name | 1-(2-Chlorophenoxy)-4-Nitrobenzene |
|---|---|
| Synonyms | 1-(2-Chlorophenoxy)-4-Nitro-Benzene; 2-Chlorophenyl 4'-Nitrophenyl Ether; Brn 1883196 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClNO3 |
| Molecular Weight | 249.65 |
| CAS Registry Number | 2091-61-4 |
| EINECS | 218-243-8 |
| SMILES | C1=CC=CC(=C1Cl)OC2=CC=C(C=C2)[N+]([O-])=O |
| InChI | 1S/C12H8ClNO3/c13-11-3-1-2-4-12(11)17-10-7-5-9(6-8-10)14(15)16/h1-8H |
| InChIKey | YRXPWHHZVCKCLN-UHFFFAOYSA-N |
| Density | 1.358g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.054°C at 760 mmHg (Cal.) |
| Flash point | 155.226°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chlorophenoxy)-4-Nitrobenzene |