| Name | (2S,3R,4S,5R)-2,3,4,5,6-Pentahydroxyhexanal |
|---|---|
| Synonyms | Idopyranose; Idose; Chebi:28014 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 |
| CAS Registry Number | 2152-76-3 |
| SMILES | [C@@H](CO)([C@@H]([C@H]([C@@H](C=O)O)O)O)O |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5+,6+/m1/s1 |
| InChIKey | GZCGUPFRVQAUEE-ZXXMMSQZSA-N |
| Density | 1.581g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.112°C at 760 mmHg (Cal.) |
| Flash point | 286.664°C (Cal.) |
| (1) | Sun Woo Kim, Sang-Hwan Kim, P. Shiv Halasyamani, Mark A. Green, Kanwal Preet Bhatti, C. Leighton, Hena Das and Craig J. Fennie. RbFeFe3F: Synthesis, structure, and characterization of a new charge-ordered magnetically frustrated pyrochlore-related mixed-metal fluoride, Chem. Sci., 2012, 3, 741. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S,3R,4S,5R)-2,3,4,5,6-Pentahydroxyhexanal |