|
CAS#: 22001-41-8 Product: Carbanilic Acid 2,4,5-Trichlorophenyl Ester No suppilers available for the product. |
| Name | Carbanilic Acid 2,4,5-Trichlorophenyl Ester |
|---|---|
| Synonyms | N-Phenylcarbamic Acid (2,4,5-Trichlorophenyl) Ester; Phenol, 2,4,5-Trichloro-, Phenylcarbamate; Phenol, 2,4,5-Trichloro-, Carbanilate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8Cl3NO2 |
| Molecular Weight | 316.57 |
| CAS Registry Number | 22001-41-8 |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OC(NC2=CC=CC=C2)=O |
| InChI | 1S/C13H8Cl3NO2/c14-9-6-11(16)12(7-10(9)15)19-13(18)17-8-4-2-1-3-5-8/h1-7H,(H,17,18) |
| InChIKey | IRZTYZDHWKOEBC-UHFFFAOYSA-N |
| Density | 1.506g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.625°C at 760 mmHg (Cal.) |
| Flash point | 199.72°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Carbanilic Acid 2,4,5-Trichlorophenyl Ester |