|
CAS#: 2289-99-8 Product: 3-(4-Nitrophenyl)-5-Phenyl-1,4,2-Dioxazole No suppilers available for the product. |
| Name | 3-(4-Nitrophenyl)-5-Phenyl-1,4,2-Dioxazole |
|---|---|
| Synonyms | 3-(4-Nitrophenyl)-5-phenyl-1,4,2-dioxazole # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 2289-99-8 |
| SMILES | [O-][N+](=O)c3ccc(C=1OC(ON=1)c2ccccc2)cc3 |
| InChI | 1S/C14H10N2O4/c17-16(18)12-8-6-10(7-9-12)13-15-20-14(19-13)11-4-2-1-3-5-11/h1-9,14H |
| InChIKey | JBEMBLMXASUTQZ-UHFFFAOYSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.495°C at 760 mmHg (Cal.) |
| Flash point | 197.827°C (Cal.) |
| Refractive index | 1.645 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Nitrophenyl)-5-Phenyl-1,4,2-Dioxazole |