|
CAS#: 28029-54-1 Product: Manganese Dinicotinate No suppilers available for the product. |
| Name | Manganese Dinicotinate |
|---|---|
| Synonyms | Manganous Pyridine-3-Carboxylate; Manganous 3-Pyridinecarboxylate; Manganous Nicotinate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8MnN2O4 |
| Molecular Weight | 299.14 |
| CAS Registry Number | 28029-54-1 |
| EINECS | 248-789-2 |
| SMILES | C1=NC=CC=C1C(=O)[O-].C2=NC=CC=C2C(=O)[O-].[Mn++] |
| InChI | 1S/2C6H5NO2.Mn/c2*8-6(9)5-2-1-3-7-4-5;/h2*1-4H,(H,8,9);/q;;+2/p-2 |
| InChIKey | DGCVKTDQGSVWLG-UHFFFAOYSA-L |
| Boiling point | 292.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 130.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese Dinicotinate |