|
CAS#: 2869-60-5 Product: 10-Methyldibenzo[def,p]Chrysene No suppilers available for the product. |
| Name | 10-Methyldibenzo[def,p]Chrysene |
|---|---|
| Synonyms | Brn 2382236; Dibenzo(Def,P)Chrysene, 10-Methyl-; 10-Methyldibenzo(Def,P)Chrysene |
| Molecular Structure | ![]() |
| Molecular Formula | C25H16 |
| Molecular Weight | 316.40 |
| CAS Registry Number | 2869-60-5 |
| SMILES | C1=CC=CC2=C1C5=C4C3=C2C=CC=C3C=CC4=CC6=C5C(=CC=C6)C |
| InChI | 1S/C25H16/c1-15-6-4-8-17-14-18-13-12-16-7-5-11-20-19-9-2-3-10-21(19)25(22(15)17)24(18)23(16)20/h2-14H,1H3 |
| InChIKey | HMJAFTKDWIHACO-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 562.053°C at 760 mmHg (Cal.) |
| Flash point | 288.807°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Methyldibenzo[def,p]Chrysene |