|
CAS#: 29635-93-6 Product: 2-{3-[(4S)-5-Oxo-1-Phenyl-2-Thioxo-4-Imidazolidinyl]Propyl}Guanidine No suppilers available for the product. |
| Name | 2-{3-[(4S)-5-Oxo-1-Phenyl-2-Thioxo-4-Imidazolidinyl]Propyl}Guanidine |
|---|---|
| Synonyms | GUANIDINE |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.37 |
| CAS Registry Number | 29635-93-6 |
| SMILES | S=C2N(c1ccccc1)C(=O)[C@@H](N2)CCC/N=C(\N)N |
| InChI | 1S/C13H17N5OS/c14-12(15)16-8-4-7-10-11(19)18(13(20)17-10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,17,20)(H4,14,15,16)/t10-/m0/s1 |
| InChIKey | ZURXKEWGRJYSHJ-JTQLQIEISA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.762°C at 760 mmHg (Cal.) |
| Flash point | 241.532°C (Cal.) |
| Refractive index | 1.704 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-{3-[(4S)-5-Oxo-1-Phenyl-2-Thioxo-4-Imidazolidinyl]Propyl}Guanidine |