Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Ammonium 4-Hydroxydithiocarbanilate |
|---|---|
| Synonyms | Ammonia; [(4-Hydroxyphenyl)Amino]Methanedithioic Acid; Nsc125374; Ammonium P-Hydroxydithiocarbanilate |
| Molecular Structure |  |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.29 |
| CAS Registry Number | 30714-45-5 |
| EINECS | 250-307-0 |
| SMILES | C1=C(NC(S)=S)C=CC(=C1)O.N |
| InChI | 1S/C7H7NOS2.H3N/c9-6-3-1-5(2-4-6)8-7(10)11;/h1-4,9H,(H2,8,10,11);1H3 |
| InChIKey | DTHRCFYLLASFIA-UHFFFAOYSA-N |
| Boiling point | 317.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 145.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 4-Hydroxydithiocarbanilate |