|
CAS#: 32047-69-1 Product: 5-Methyl-11H-Benzo[b][1,4]Benzodiazepin-6-One No suppilers available for the product. |
| Name | 5-Methyl-11H-Benzo[b][1,4]Benzodiazepin-6-One |
|---|---|
| Synonyms | 5-24-04-00110 (Beilstein Handbook Reference); Brn 0654203; 10-Methyl-5,10-Dihydro-11H-Dibenzo(B,E)(1,4)Diazepin-11-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 |
| CAS Registry Number | 32047-69-1 |
| SMILES | C1=CC=CC2=C1N(C(=O)C3=C(N2)C=CC=C3)C |
| InChI | 1S/C14H12N2O/c1-16-13-9-5-4-8-12(13)15-11-7-3-2-6-10(11)14(16)17/h2-9,15H,1H3 |
| InChIKey | NLKSFKLPWZLDGG-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.44°C at 760 mmHg (Cal.) |
| Flash point | 205.051°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-11H-Benzo[b][1,4]Benzodiazepin-6-One |