| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Name | Heptafluorobutyraldehyde Ethyl Hemiacetal |
|---|---|
| Synonyms | 1-Ethoxy-2,2,3,3,4,4,4-Heptafluoro-Butan-1-Ol; Nsc 65878 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7F7O2 |
| Molecular Weight | 244.11 |
| CAS Registry Number | 356-26-3 |
| EINECS | 206-601-6 |
| SMILES | C(OC(C(C(C(F)(F)F)(F)F)(F)F)O)C |
| InChI | 1S/C6H7F7O2/c1-2-15-3(14)4(7,8)5(9,10)6(11,12)13/h3,14H,2H2,1H3 |
| InChIKey | NPUHUJNJOILQJC-UHFFFAOYSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 104.105°C at 760 mmHg (Cal.) |
| Flash point | 55.755°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptafluorobutyraldehyde Ethyl Hemiacetal |