|
CAS#: 40643-39-8 Product: 3-Methyl-1-(4-Nitrophenyl)Triazene No suppilers available for the product. |
| Name | 3-Methyl-1-(4-Nitrophenyl)Triazene |
|---|---|
| Synonyms | N-Methylazo-4-Nitro-Aniline; N-Methylazo-4-Nitroaniline; Methylazo-(4-Nitrophenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 |
| CAS Registry Number | 40643-39-8 |
| SMILES | C1=CC(=CC=C1NN=NC)[N+]([O-])=O |
| InChI | 1S/C7H8N4O2/c1-8-10-9-6-2-4-7(5-3-6)11(12)13/h2-5H,1H3,(H,8,9) |
| InChIKey | BDSNQOSDUXHMCI-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.024°C at 760 mmHg (Cal.) |
| Flash point | 130.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-1-(4-Nitrophenyl)Triazene |