|
CAS#: 427-79-2 Product: Allogibberic Acid No suppilers available for the product. |
| Name | Allogibberic Acid |
|---|---|
| Synonyms | C09061 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 |
| CAS Registry Number | 427-79-2 |
| SMILES | [C@@H]1(C(=O)O)[C@]34[C@@H](C2=CC=CC(=C12)C)CC[C@](C3)(C(C4)=C)O |
| InChI | 1S/C18H20O3/c1-10-4-3-5-12-13-6-7-18(21)9-17(13,8-11(18)2)15(14(10)12)16(19)20/h3-5,13,15,21H,2,6-9H2,1H3,(H,19,20)/t13-,15-,17+,18+/m1/s1 |
| InChIKey | IFYWTLQMNWNCFH-WCZJQEMASA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.643°C at 760 mmHg (Cal.) |
| Flash point | 263.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allogibberic Acid |