|
CAS#: 51818-56-5 Product: Neodecanoic Acid, Nickel Salt No suppilers available for the product. |
| Name | Neodecanoic Acid, Nickel Salt |
|---|---|
| Synonyms | Nickelous 7,7-Dimethyloctanoate; Nickelous 7,7-Dimethylcaprylate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H38NiO4 |
| Molecular Weight | 401.21 |
| CAS Registry Number | 51818-56-5 |
| EINECS | 257-447-1 |
| SMILES | C(C(C)(C)C)CCCCC([O-])=O.C(C(C)(C)C)CCCCC([O-])=O.[Ni++] |
| InChI | 1S/2C10H20O2.Ni/c2*1-10(2,3)8-6-4-5-7-9(11)12;/h2*4-8H2,1-3H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | VNBCIRBFLBYHCW-UHFFFAOYSA-L |
| Boiling point | 265.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Neodecanoic Acid, Nickel Salt |