|
CAS#: 53065-28-4 Product: Fenbendazoleamine No suppilers available for the product. |
| Name | Fenbendazoleamine |
|---|---|
| Synonyms | 6-(Phenylthio)-1H-Benzimidazol-2-Amine; [6-(Phenylthio)-1H-Benzimidazol-2-Yl]Amine; 1H-Benzimidazol-2-Amine, 5-(Phenylthio)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.31 |
| CAS Registry Number | 53065-28-4 |
| SMILES | C2=C1[NH]C(=NC1=CC=C2SC3=CC=CC=C3)N |
| InChI | 1S/C13H11N3S/c14-13-15-11-7-6-10(8-12(11)16-13)17-9-4-2-1-3-5-9/h1-8H,(H3,14,15,16) |
| InChIKey | OJDMYVLGXHUDMW-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.783°C at 760 mmHg (Cal.) |
| Flash point | 259.688°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fenbendazoleamine |