|
CAS#: 61361-58-8 Product: N-(2-Bromoethyl)-2-Methoxy-5-Nitrobenzylamine No suppilers available for the product. |
| Name | N-(2-Bromoethyl)-2-Methoxy-5-Nitrobenzylamine |
|---|---|
| Synonyms | 2-Bromo-N-[(2-Methoxy-5-Nitro-Phenyl)Methyl]Ethanamine; 2-Bromoethyl-(2-Methoxy-5-Nitro-Benzyl)Amine; Benzylamine, N-(2-Bromoethyl)-2-Methoxy-5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 |
| CAS Registry Number | 61361-58-8 |
| SMILES | C1=C(C(=CC=C1[N+]([O-])=O)OC)CNCCBr |
| InChI | 1S/C10H13BrN2O3/c1-16-10-3-2-9(13(14)15)6-8(10)7-12-5-4-11/h2-3,6,12H,4-5,7H2,1H3 |
| InChIKey | OSWYWBCJIVTSBT-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.721°C at 760 mmHg (Cal.) |
| Flash point | 194.94°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Bromoethyl)-2-Methoxy-5-Nitrobenzylamine |