Online Database of Chemicals from Around the World
| Name | 1,4-Bis[4-(Trifluoromethyl)Phenoxy]Benzene |
|---|---|
| Synonyms | 1,4-Bis(4-(Trifluoromethyl)Phenoxy)Benzene |
| Molecular Structure | ![CAS#: 67525-36-4, 1,4-Bis[4-(Trifluoromethyl)Phenoxy]Benzene](/moreStructures/67525-36-4.gif) |
| Molecular Formula | C20H12F6O2 |
| Molecular Weight | 398.30 |
| CAS Registry Number | 67525-36-4 |
| EINECS | 266-712-0 |
| SMILES | C1=C(C(F)(F)F)C=CC(=C1)OC3=CC=C(OC2=CC=C(C(F)(F)F)C=C2)C=C3 |
| InChI | 1S/C20H12F6O2/c21-19(22,23)13-1-5-15(6-2-13)27-17-9-11-18(12-10-17)28-16-7-3-14(4-8-16)20(24,25)26/h1-12H |
| InChIKey | DBEALIZXNCCVBG-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.994°C at 760 mmHg (Cal.) |
| Flash point | 197.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis[4-(Trifluoromethyl)Phenoxy]Benzene |
