|
CAS#: 67634-21-3 Product: 4-Isopropylbenzyl Formate No suppilers available for the product. |
| Name | 4-Isopropylbenzyl Formate |
|---|---|
| Synonyms | (4-Isopropylphenyl)Methyl Formate; Formic Acid (4-Isopropylphenyl)Methyl Ester; Formic Acid (4-Isopropylbenzyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 67634-21-3 |
| EINECS | 266-826-0 |
| SMILES | C1=C(C=CC(=C1)COC=O)C(C)C |
| InChI | 1S/C11H14O2/c1-9(2)11-5-3-10(4-6-11)7-13-8-12/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | UZFIDCCOGFHAHO-UHFFFAOYSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.896°C at 760 mmHg (Cal.) |
| Flash point | 115.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Isopropylbenzyl Formate |