|
CAS#: 68658-41-3 Product: 2-chloro-6-(3-chloro-2-hydroxy-5-methyl-phenyl)sulfanyl-4-methyl-phenol No suppilers available for the product. |
| Name | 2-chloro-6-(3-chloro-2-hydroxy-5-methyl-phenyl)sulfanyl-4-methyl-phenol |
|---|---|
| Synonyms | 2,2'-thiobis[6-chloro-p-cresol] |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12Cl2O2S |
| Molecular Weight | 315.21 |
| CAS Registry Number | 68658-41-3 |
| EINECS | 272-052-4 |
| SMILES | Oc2c(Sc1cc(C)cc(Cl)c1O)cc(C)cc2Cl |
| InChI | 1S/C14H12Cl2O2S/c1-7-3-9(15)13(17)11(5-7)19-12-6-8(2)4-10(16)14(12)18/h3-6,17-18H,1-2H3 |
| InChIKey | MREHSIFYCIVVAS-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.908°C at 760 mmHg (Cal.) |
| Flash point | 196.867°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-chloro-6-(3-chloro-2-hydroxy-5-methyl-phenyl)sulfanyl-4-methyl-phenol |