|
CAS#: 68795-14-2 Product: Pentabromodibenzofuran No suppilers available for the product. |
| Name | Pentabromodibenzofuran |
|---|---|
| Synonyms | 1,2,4,7,9-Pentabromo-Dibenzofuran; Pentabromodibenzofuran |
| Molecular Structure | ![]() |
| Molecular Formula | C12H3Br5O |
| Molecular Weight | 562.68 |
| CAS Registry Number | 68795-14-2 |
| SMILES | C1=C(C(=C2C(=C1Br)OC3=CC(=CC(=C23)Br)Br)Br)Br |
| InChI | 1S/C12H3Br5O/c13-4-1-5(14)9-8(2-4)18-12-7(16)3-6(15)11(17)10(9)12/h1-3H |
| InChIKey | KYCXSUKOCJIDGC-UHFFFAOYSA-N |
| Density | 2.542g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.578°C at 760 mmHg (Cal.) |
| Flash point | 264.403°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentabromodibenzofuran |