|
CAS#: 69095-88-1 Product: 3-(2-Ethylphenyl)-5-Phenyl-1H-1,2,4-Triazole No suppilers available for the product. |
| Name | 3-(2-Ethylphenyl)-5-Phenyl-1H-1,2,4-Triazole |
|---|---|
| Synonyms | 1H-1,2,4-Triazole, 3-(2-Ethylphenyl)-5-Phenyl-; 3-(2-Ethylphenyl)-5-Phenyl-1H-1,2,4-Triazole; 3-(O-Ethylphenyl)-5-Phenyl-S-Triazole |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.31 |
| CAS Registry Number | 69095-88-1 |
| SMILES | C1=C(C(=CC=C1)C2=NC(=N[NH]2)C3=CC=CC=C3)CC |
| InChI | 1S/C16H15N3/c1-2-12-8-6-7-11-14(12)16-17-15(18-19-16)13-9-4-3-5-10-13/h3-11H,2H2,1H3,(H,17,18,19) |
| InChIKey | BQKLBSZNFCZZQE-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.58°C at 760 mmHg (Cal.) |
| Flash point | 212.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Ethylphenyl)-5-Phenyl-1H-1,2,4-Triazole |