|
CAS#: 69209-20-7 Product: 4-Bis(Trimethylsilylmethylthio)Benzene No suppilers available for the product. |
| Name | 4-Bis(Trimethylsilylmethylthio)Benzene |
|---|---|
| Synonyms | Trimethyl-[[[4-(Trimethylsilylmethylthio)Phenyl]Thio]Methyl]Silane; 4-Bis(Trimethylsilylmethylthio)Benzene; P-Bis(Trimethylsilylmethylthio)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H26S2Si2 |
| Molecular Weight | 314.65 |
| CAS Registry Number | 69209-20-7 |
| SMILES | C1=CC(=CC=C1SC[Si](C)(C)C)SC[Si](C)(C)C |
| InChI | 1S/C14H26S2Si2/c1-17(2,3)11-15-13-7-9-14(10-8-13)16-12-18(4,5)6/h7-10H,11-12H2,1-6H3 |
| InChIKey | UXQPPWIIYMOCFL-UHFFFAOYSA-N |
| Density | 0.983g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.111°C at 760 mmHg (Cal.) |
| Flash point | 167.961°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bis(Trimethylsilylmethylthio)Benzene |