|
CAS#: 70556-54-6 Product: 2-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Pent-1-En-3-One No suppilers available for the product. |
| Name | 2-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Pent-1-En-3-One |
|---|---|
| Synonyms | 2-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Pent-1-En-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 70556-54-6 |
| EINECS | 274-671-5 |
| SMILES | C(C(=O)C(=C/C1CC=C(CC1)C)/C)C |
| InChI | 1S/C13H20O/c1-4-13(14)11(3)9-12-7-5-10(2)6-8-12/h5,9,12H,4,6-8H2,1-3H3/b11-9+ |
| InChIKey | NSPDRVIQAXARPO-PKNBQFBNSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.267°C at 760 mmHg (Cal.) |
| Flash point | 124.849°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Pent-1-En-3-One |