Online Database of Chemicals from Around the World
|
CAS#: 7154-68-9 Product: 5,8-Dimethoxy-2-Methyl-4H-1-Benzopyran-4-One No suppilers available for the product. |
| Name | 5,8-Dimethoxy-2-Methyl-4H-1-Benzopyran-4-One |
|---|---|
| Synonyms | 5,8-Dimethoxy-2-Methyl-Chromen-4-One; 5,8-Dimethoxy-2-Methyl-4-Chromenone; 5,8-Dimethoxy-2-Methyl-Chromone |
| Molecular Structure |  |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 |
| CAS Registry Number | 7154-68-9 |
| SMILES | C1=C(C2=C(C(=C1)OC)C(C=C(O2)C)=O)OC |
| InChI | 1S/C12H12O4/c1-7-6-8(13)11-9(14-2)4-5-10(15-3)12(11)16-7/h4-6H,1-3H3 |
| InChIKey | UFCZYGOJPCRTPW-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.518°C at 760 mmHg (Cal.) |
| Flash point | 170.712°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,8-Dimethoxy-2-Methyl-4H-1-Benzopyran-4-One |