|
CAS#: 71550-20-4 Product: 2-(2-Chloro-5-Methylbenzoyl)Benzoic Acid No suppilers available for the product. |
| Name | 2-(2-Chloro-5-Methylbenzoyl)Benzoic Acid |
|---|---|
| Synonyms | 2-(2-Chloro-5-Methyl-Benzoyl)Benzoic Acid; 2-[(2-Chloro-5-Methylphenyl)-Oxomethyl]Benzoic Acid; 2-(2-Chloro-5-Methyl-Phenyl)Carbonylbenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.70 |
| CAS Registry Number | 71550-20-4 |
| SMILES | C1=CC(=CC(=C1Cl)C(=O)C2=C(C=CC=C2)C(=O)O)C |
| InChI | 1S/C15H11ClO3/c1-9-6-7-13(16)12(8-9)14(17)10-4-2-3-5-11(10)15(18)19/h2-8H,1H3,(H,18,19) |
| InChIKey | OACHMRGCIDBGJG-UHFFFAOYSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.123°C at 760 mmHg (Cal.) |
| Flash point | 247.194°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Chloro-5-Methylbenzoyl)Benzoic Acid |