|
CAS#: 73771-89-8 Product: (1,1-Dimethylpiperidin-1-Ium-4-Yl) 3,4,5-Trimethoxybenzoate Bromide No suppilers available for the product. |
| Name | (1,1-Dimethylpiperidin-1-Ium-4-Yl) 3,4,5-Trimethoxybenzoate Bromide |
|---|---|
| Synonyms | 3,4,5-Trimethoxybenzoic Acid (1,1-Dimethyl-4-Piperidin-1-Iumyl) Ester Bromide; 3,4,5-Trimethoxybenzoic Acid (1,1-Dimethylpiperidin-1-Ium-4-Yl) Ester Bromide; Piperidinium 1,1-Dimethyl-4-(3,4,5-Trimethoxybenzoyloxy)-, Bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26BrNO5 |
| Molecular Weight | 404.30 |
| CAS Registry Number | 73771-89-8 |
| SMILES | C1=C(C(=C(C=C1C(OC2CC[N+](CC2)(C)C)=O)OC)OC)OC.[Br-] |
| InChI | 1S/C17H26NO5.BrH/c1-18(2)8-6-13(7-9-18)23-17(19)12-10-14(20-3)16(22-5)15(11-12)21-4;/h10-11,13H,6-9H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | URDIWLSVYRUCLK-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for (1,1-Dimethylpiperidin-1-Ium-4-Yl) 3,4,5-Trimethoxybenzoate Bromide |