Online Database of Chemicals from Around the World
| Name | 1,1,2,2,3,3,4,4,5,5-Decafluoro-1-[(Trifluorovinyl)Oxy]Pentane |
|---|---|
| Synonyms | 1-(1,1,2,2,3,3,4,4,5,5-Decafluoropentoxy)-1,2,2-Trifluoro-Ethylene; 1,1,2,2,3,3,4,4,5,5-Decafluoro-1-((Trifluorovinyl)Oxy)Pentane |
| Molecular Structure | ![CAS#: 73928-40-2, 1,1,2,2,3,3,4,4,5,5-Decafluoro-1-[(Trifluorovinyl)Oxy]Pentane](/moreStructures/73928-40-2.gif) |
| Molecular Formula | C7HF13O |
| Molecular Weight | 348.06 |
| CAS Registry Number | 73928-40-2 |
| EINECS | 277-639-9 |
| SMILES | C(F)(F)=C(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | 1S/C7HF13O/c8-1(9)2(10)21-7(19,20)6(17,18)5(15,16)4(13,14)3(11)12/h3H |
| InChIKey | IBBCNYCWBLECNN-UHFFFAOYSA-N |
| Density | 1.618g/cm3 (Cal.) |
|---|---|
| Boiling point | 123.657°C at 760 mmHg (Cal.) |
| Flash point | 34.254°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5-Decafluoro-1-[(Trifluorovinyl)Oxy]Pentane |
